C21H15ClN2OS — CID 54857994
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-chlorobenzamide (PubChem CID 54857994) has the molecular formula C21H15ClN2OS and a molecular weight of 378.88 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-chlorobenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 54857994 |
| Molecular Formula | C21H15ClN2OS |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-chlorobenzamide |
| SMILES | O=C(Nc1ccc(Cc2nc3ccccc3s2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H15ClN2OS/c22-16-5-3-4-15(13-16)21(25)23-17-10-8-14(9-11-17)12-20-24-18-6-1-2-7-19(18)26-20/h1-11,13H,12H2,(H,23,25) |
| InChIKey | IOJUXHCPFPHPEL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |