C22H15N3OS — CID 8699402
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-cyanobenzamide (PubChem CID 8699402) has the molecular formula C22H15N3OS and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-cyanobenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 8699402 |
| Molecular Formula | C22H15N3OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-cyanobenzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(Cc3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C22H15N3OS/c23-14-16-5-9-17(10-6-16)22(26)24-18-11-7-15(8-12-18)13-21-25-19-3-1-2-4-20(19)27-21/h1-12H,13H2,(H,24,26) |
| InChIKey | AGLFLAXVWRLSAK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |