C26H25N3O2S2 — CID 54859202
N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-4-butoxybenzamide (PubChem CID 54859202) has the molecular formula C26H25N3O2S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-4-butoxybenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 54859202 |
| Molecular Formula | C26H25N3O2S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2ccc(Cc3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O2S2/c1-2-3-16-31-21-14-10-19(11-15-21)25(30)29-26(32)27-20-12-8-18(9-13-20)17-24-28-22-6-4-5-7-23(22)33-24/h4-15H,2-3,16-17H2,1H3,(H2,27,29,30,32) |
| InChIKey | KOJSTPONMJWNCZ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|