C26H19N3OS2 — CID 54859148
N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 54859148) has the molecular formula C26H19N3OS2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 54859148 |
| Molecular Formula | C26H19N3OS2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cc2nc3ccccc3s2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H19N3OS2/c30-25(21-9-5-7-18-6-1-2-8-20(18)21)29-26(31)27-19-14-12-17(13-15-19)16-24-28-22-10-3-4-11-23(22)32-24/h1-15H,16H2,(H2,27,29,30,31) |
| InChIKey | DWWNGSUACYLYFQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|