C19H13N3OS2 — CID 3442954
N-(1,3-benzothiazol-2-ylcarbamothioyl)naphthalene-1-carboxamide (PubChem CID 3442954) has the molecular formula C19H13N3OS2 and a molecular weight of 363.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylcarbamothioyl)naphthalene-1-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylcarbamothioyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3442954 |
| Molecular Formula | C19H13N3OS2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylcarbamothioyl)naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc2ccccc2s1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H13N3OS2/c23-17(14-9-5-7-12-6-1-2-8-13(12)14)21-18(24)22-19-20-15-10-3-4-11-16(15)25-19/h1-11H,(H2,20,21,22,23,24) |
| InChIKey | QZWQPAKDPCUSFB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|