C20H14Cl3N3OS — CID 18879602
N-[1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide (PubChem CID 18879602) has the molecular formula C20H14Cl3N3OS and a molecular weight of 450.78 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide.
| Compound Name | N-[1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 18879602 |
| Molecular Formula | C20H14Cl3N3OS |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(Nc1nc2ccccc2s1)C(Cl)(Cl)Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H14Cl3N3OS/c21-20(22,23)18(26-19-24-15-10-3-4-11-16(15)28-19)25-17(27)14-9-5-7-12-6-1-2-8-13(12)14/h1-11,18H,(H,24,26)(H,25,27) |
| InChIKey | DSOIRSFEPZXRSW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|