C9H7Cl3N2OS — CID 779271
(1R)-1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethanol (PubChem CID 779271) has the molecular formula C9H7Cl3N2OS and a molecular weight of 297.59 g/mol. Its IUPAC name is (1R)-1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethanol.
| Compound Name | (1R)-1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethanol |
|---|---|
| PubChem CID | 779271 |
| Molecular Formula | C9H7Cl3N2OS |
| Molecular Weight | 297.59 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | (1R)-1-(1,3-benzothiazol-2-ylamino)-2,2,2-trichloroethanol |
| SMILES | O[C@@H](Nc1nc2ccccc2s1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H7Cl3N2OS/c10-9(11,12)7(15)14-8-13-5-3-1-2-4-6(5)16-8/h1-4,7,15H,(H,13,14)/t7-/m1/s1 |
| InChIKey | VPXGGKJBKDHEPE-SSDOTTSWSA-N |
| XLogP | 3.40 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|