C11H14N2S — CID 591708
N-butan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 591708) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is N-butan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-butan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 591708 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-butan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CCC(C)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H14N2S/c1-3-8(2)12-11-13-9-6-4-5-7-10(9)14-11/h4-8H,3H2,1-2H3,(H,12,13) |
| InChIKey | NIQUVXGLIIIHKS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |