C11H14N2S2 — CID 21196958
N-(1,3-benzothiazol-2-ylsulfanyl)butan-2-amine (PubChem CID 21196958) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)butan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 21196958 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)butan-2-amine |
| SMILES | CCC(C)NSc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H14N2S2/c1-3-8(2)13-15-11-12-9-6-4-5-7-10(9)14-11/h4-8,13H,3H2,1-2H3 |
| InChIKey | ZRWRRNLNASXEBY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|