C8H6N2Na2O6P2S-2 — CID 19992041
disodium;N-(diphosphonatomethyl)-1,3-benzothiazol-2-amine (PubChem CID 19992041) has the molecular formula C8H6N2Na2O6P2S-2 and a molecular weight of 366.14 g/mol. Its IUPAC name is disodium;N-(diphosphonatomethyl)-1,3-benzothiazol-2-amine.
| Compound Name | disodium;N-(diphosphonatomethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 19992041 |
| Molecular Formula | C8H6N2Na2O6P2S-2 |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | disodium;N-(diphosphonatomethyl)-1,3-benzothiazol-2-amine |
| SMILES | O=P([O-])([O-])C(Nc1nc2ccccc2s1)P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H10N2O6P2S.2Na/c11-17(12,13)8(18(14,15)16)10-7-9-5-3-1-2-4-6(5)19-7;;/h1-4,8H,(H,9,10)(H2,11,12,13)(H2,14,15,16);;/q;2*+1/p-4 |
| InChIKey | QSLBZJWWNAWRJZ-UHFFFAOYSA-J |
| XLogP | -7.17 |
| TPSA | 151.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | -7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|