C19H23N2O3PS — CID 102493388
N-[diethoxyphosphoryl-(4-methylphenyl)methyl]-1,3-benzothiazol-2-amine (PubChem CID 102493388) has the molecular formula C19H23N2O3PS and a molecular weight of 390.45 g/mol. Its IUPAC name is N-[diethoxyphosphoryl-(4-methylphenyl)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[diethoxyphosphoryl-(4-methylphenyl)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 102493388 |
| Molecular Formula | C19H23N2O3PS |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[diethoxyphosphoryl-(4-methylphenyl)methyl]-1,3-benzothiazol-2-amine |
| SMILES | CCOP(=O)(OCC)C(Nc1nc2ccccc2s1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N2O3PS/c1-4-23-25(22,24-5-2)18(15-12-10-14(3)11-13-15)21-19-20-16-8-6-7-9-17(16)26-19/h6-13,18H,4-5H2,1-3H3,(H,20,21) |
| InChIKey | LPIXVUONTRTOEG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|