C16H14N2O4S2 — CID 162657138
2-(1,3-benzothiazol-2-ylamino)-1-(4-methylphenyl)-2-oxoethanesulfonic acid (PubChem CID 162657138) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-1-(4-methylphenyl)-2-oxoethanesulfonic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-1-(4-methylphenyl)-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 162657138 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-1-(4-methylphenyl)-2-oxoethanesulfonic acid |
| SMILES | Cc1ccc(C(C(=O)Nc2nc3ccccc3s2)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H14N2O4S2/c1-10-6-8-11(9-7-10)14(24(20,21)22)15(19)18-16-17-12-4-2-3-5-13(12)23-16/h2-9,14H,1H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | CGIHSSPGGIXHSI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|