C13H16N2O3S — CID 81078689
2-(1,3-benzothiazol-2-ylamino)-5-methoxypentanoic acid (PubChem CID 81078689) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-5-methoxypentanoic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81078689 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-5-methoxypentanoic acid |
| SMILES | COCCCC(Nc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C13H16N2O3S/c1-18-8-4-6-10(12(16)17)15-13-14-9-5-2-3-7-11(9)19-13/h2-3,5,7,10H,4,6,8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | CVWIOQHAMZVNKI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|