C14H18N2O5S2 — CID 108773507
4-ethylsulfonyl-2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]butanoic acid (PubChem CID 108773507) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]butanoic acid.
| Compound Name | 4-ethylsulfonyl-2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 108773507 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-ethylsulfonyl-2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]butanoic acid |
| SMILES | CCS(=O)(=O)CCC(Nc1nc2ccc(OC)cc2s1)C(=O)O |
| InChI | InChI=1S/C14H18N2O5S2/c1-3-23(19,20)7-6-11(13(17)18)16-14-15-10-5-4-9(21-2)8-12(10)22-14/h4-5,8,11H,3,6-7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | RSGDHWDODBYXNJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |