C13H15ClN2O2S2 — CID 108777972
2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-ethylsulfanylbutanoic acid (PubChem CID 108777972) has the molecular formula C13H15ClN2O2S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108777972 |
| Molecular Formula | C13H15ClN2O2S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(Nc1nc2ccc(Cl)cc2s1)C(=O)O |
| InChI | InChI=1S/C13H15ClN2O2S2/c1-2-19-6-5-10(12(17)18)16-13-15-9-4-3-8(14)7-11(9)20-13/h3-4,7,10H,2,5-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | XHRATXRVCSDJIW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|