C17H17ClN2S — CID 79526366
6-chloro-N-(4-phenylbutan-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 79526366) has the molecular formula C17H17ClN2S and a molecular weight of 316.86 g/mol. Its IUPAC name is 6-chloro-N-(4-phenylbutan-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-(4-phenylbutan-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79526366 |
| Molecular Formula | C17H17ClN2S |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 6-chloro-N-(4-phenylbutan-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | CC(CCc1ccccc1)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C17H17ClN2S/c1-12(7-8-13-5-3-2-4-6-13)19-17-20-15-10-9-14(18)11-16(15)21-17/h2-6,9-12H,7-8H2,1H3,(H,19,20) |
| InChIKey | ZRMFUHQEBVFEPT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |