About 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine
1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine (PubChem CID 114917838) has the molecular formula C16H15ClN2S
and a molecular weight of 302.83 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine |
| PubChem CID | 114917838 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine |
| SMILES | NC(CCc1ccccc1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C16H15ClN2S/c17-12-7-9-14-15(10-12)20-16(19-14)13(18)8-6-11-4-2-1-3-5-11/h1-5,7,9-10,13H,6,8,18H2 |
| InChIKey | NHXYZLXNHNXLAO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine?
The IUPAC name of 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine (CID 114917838) is 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine.
What is the SMILES notation for 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine?
The canonical SMILES for 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine is NC(CCc1ccccc1)c1nc2ccc(Cl)cc2s1.
What is the InChIKey of 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine?
The InChIKey is NHXYZLXNHNXLAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2S/c17-12-7-9-14-15(10-12)20-16(19-14)13(18)8-6-11-4-2-1-3-5-11/h1-5,7,9-10,13H,6,8,18H2.
What are the key properties of 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine?
1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine has a molecular weight of 302.83 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-1,3-benzothiazol-2-yl)-3-phenylpropan-1-amine is sourced from PubChem (CID 114917838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).