C12H13N3O3S2 — CID 75047660
methyl 2-(1,3-benzothiazol-2-ylamino)-4-nitrososulfanylbutanoate (PubChem CID 75047660) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is methyl 2-(1,3-benzothiazol-2-ylamino)-4-nitrososulfanylbutanoate.
| Compound Name | methyl 2-(1,3-benzothiazol-2-ylamino)-4-nitrososulfanylbutanoate |
|---|---|
| PubChem CID | 75047660 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | methyl 2-(1,3-benzothiazol-2-ylamino)-4-nitrososulfanylbutanoate |
| SMILES | COC(=O)C(CCSN=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-18-11(16)9(6-7-19-15-17)14-12-13-8-4-2-3-5-10(8)20-12/h2-5,9H,6-7H2,1H3,(H,13,14) |
| InChIKey | WLNMOHYMLTYZSW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|