C14H19N3O2S — CID 63231298
methyl 2-[(6-amino-1,3-benzothiazol-2-yl)amino]-4-methylpentanoate (PubChem CID 63231298) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is methyl 2-[(6-amino-1,3-benzothiazol-2-yl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(6-amino-1,3-benzothiazol-2-yl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 63231298 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | methyl 2-[(6-amino-1,3-benzothiazol-2-yl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C14H19N3O2S/c1-8(2)6-11(13(18)19-3)17-14-16-10-5-4-9(15)7-12(10)20-14/h4-5,7-8,11H,6,15H2,1-3H3,(H,16,17) |
| InChIKey | UTLRBQQFKYIQPZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|