C12H15N3O3S2 — CID 61288036
N-(6-amino-1,3-benzothiazol-2-yl)-2-(2-methoxyethylsulfinyl)acetamide (PubChem CID 61288036) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-(2-methoxyethylsulfinyl)acetamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-(2-methoxyethylsulfinyl)acetamide |
|---|---|
| PubChem CID | 61288036 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-(2-methoxyethylsulfinyl)acetamide |
| SMILES | COCCS(=O)CC(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-18-4-5-20(17)7-11(16)15-12-14-9-3-2-8(13)6-10(9)19-12/h2-3,6H,4-5,7,13H2,1H3,(H,14,15,16) |
| InChIKey | JEXOBDLBSROTAO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|