C15H19N3O2S — CID 28535611
N-(6-amino-1,3-benzothiazol-2-yl)-4-(cyclopropylmethoxy)butanamide (PubChem CID 28535611) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-4-(cyclopropylmethoxy)butanamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-4-(cyclopropylmethoxy)butanamide |
|---|---|
| PubChem CID | 28535611 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-4-(cyclopropylmethoxy)butanamide |
| SMILES | Nc1ccc2nc(NC(=O)CCCOCC3CC3)sc2c1 |
| InChI | InChI=1S/C15H19N3O2S/c16-11-5-6-12-13(8-11)21-15(17-12)18-14(19)2-1-7-20-9-10-3-4-10/h5-6,8,10H,1-4,7,9,16H2,(H,17,18,19) |
| InChIKey | PCDIMUMLUGGSCF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|