C14H21N5OS — CID 63693372
N-(6-amino-1,3-benzothiazol-2-yl)-2-[2-(dimethylamino)ethyl-methylamino]acetamide (PubChem CID 63693372) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-[2-(dimethylamino)ethyl-methylamino]acetamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-[2-(dimethylamino)ethyl-methylamino]acetamide |
|---|---|
| PubChem CID | 63693372 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-[2-(dimethylamino)ethyl-methylamino]acetamide |
| SMILES | CN(C)CCN(C)CC(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C14H21N5OS/c1-18(2)6-7-19(3)9-13(20)17-14-16-11-5-4-10(15)8-12(11)21-14/h4-5,8H,6-7,9,15H2,1-3H3,(H,16,17,20) |
| InChIKey | KXMULTYXSGGRIY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|