C14H16N2O3S2 — CID 75047557
methyl 4-acetylsulfanyl-2-(1,3-benzothiazol-2-ylamino)butanoate (PubChem CID 75047557) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is methyl 4-acetylsulfanyl-2-(1,3-benzothiazol-2-ylamino)butanoate.
| Compound Name | methyl 4-acetylsulfanyl-2-(1,3-benzothiazol-2-ylamino)butanoate |
|---|---|
| PubChem CID | 75047557 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl 4-acetylsulfanyl-2-(1,3-benzothiazol-2-ylamino)butanoate |
| SMILES | COC(=O)C(CCSC(C)=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-9(17)20-8-7-11(13(18)19-2)16-14-15-10-5-3-4-6-12(10)21-14/h3-6,11H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | MJHVZKRTFBPZRR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|