C22H26F3N2O3PS — CID 101447054
N-[dipropoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 101447054) has the molecular formula C22H26F3N2O3PS and a molecular weight of 486.50 g/mol. Its IUPAC name is N-[dipropoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[dipropoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 101447054 |
| Molecular Formula | C22H26F3N2O3PS |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | N-[dipropoxyphosphoryl-[4-(trifluoromethyl)phenyl]methyl]-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCCOP(=O)(OCCC)C(Nc1nc2c(C)cccc2s1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F3N2O3PS/c1-4-13-29-31(28,30-14-5-2)20(16-9-11-17(12-10-16)22(23,24)25)27-21-26-19-15(3)7-6-8-18(19)32-21/h6-12,20H,4-5,13-14H2,1-3H3,(H,26,27) |
| InChIKey | GNXOAYYGWSGCRG-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|