C26H26N2O4S — CID 56590070
diethyl 2-[[(4-methyl-1,3-benzothiazol-2-yl)amino]-naphthalen-1-ylmethyl]propanedioate (PubChem CID 56590070) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is diethyl 2-[[(4-methyl-1,3-benzothiazol-2-yl)amino]-naphthalen-1-ylmethyl]propanedioate.
| Compound Name | diethyl 2-[[(4-methyl-1,3-benzothiazol-2-yl)amino]-naphthalen-1-ylmethyl]propanedioate |
|---|---|
| PubChem CID | 56590070 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | diethyl 2-[[(4-methyl-1,3-benzothiazol-2-yl)amino]-naphthalen-1-ylmethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(Nc1nc2c(C)cccc2s1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H26N2O4S/c1-4-31-24(29)21(25(30)32-5-2)23(19-14-9-12-17-11-6-7-13-18(17)19)28-26-27-22-16(3)10-8-15-20(22)33-26/h6-15,21,23H,4-5H2,1-3H3,(H,27,28) |
| InChIKey | LYMJOAKSSBTZBH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|