C15H19NO2S — CID 79474975
ethyl 3-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)butanoate (PubChem CID 79474975) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is ethyl 3-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)butanoate.
| Compound Name | ethyl 3-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 79474975 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | ethyl 3-methyl-2-(4-methyl-1,3-benzothiazol-2-yl)butanoate |
| SMILES | CCOC(=O)C(c1nc2c(C)cccc2s1)C(C)C |
| InChI | InChI=1S/C15H19NO2S/c1-5-18-15(17)12(9(2)3)14-16-13-10(4)7-6-8-11(13)19-14/h6-9,12H,5H2,1-4H3 |
| InChIKey | HNBZAESYHHRQTN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |