C12H15N3OS — CID 79146680
N-[2-[(4-methyl-1,3-benzothiazol-2-yl)amino]ethyl]acetamide (PubChem CID 79146680) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[2-[(4-methyl-1,3-benzothiazol-2-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(4-methyl-1,3-benzothiazol-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 79146680 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-[2-[(4-methyl-1,3-benzothiazol-2-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-4-3-5-10-11(8)15-12(17-10)14-7-6-13-9(2)16/h3-5H,6-7H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | RIGRLUMKIQKFPY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|