C11H14N2S2 — CID 79147292
4-methyl-N-(2-methylsulfanylethyl)-1,3-benzothiazol-2-amine (PubChem CID 79147292) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 4-methyl-N-(2-methylsulfanylethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-methyl-N-(2-methylsulfanylethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79147292 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-methyl-N-(2-methylsulfanylethyl)-1,3-benzothiazol-2-amine |
| SMILES | CSCCNc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C11H14N2S2/c1-8-4-3-5-9-10(8)13-11(15-9)12-6-7-14-2/h3-5H,6-7H2,1-2H3,(H,12,13) |
| InChIKey | DYVVDYPSKJHVHX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|