C16H22N2S — CID 79146937
N-(2-cyclohexylethyl)-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 79146937) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-cyclohexylethyl)-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79146937 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(2-cyclohexylethyl)-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(NCCC3CCCCC3)nc12 |
| InChI | InChI=1S/C16H22N2S/c1-12-6-5-9-14-15(12)18-16(19-14)17-11-10-13-7-3-2-4-8-13/h5-6,9,13H,2-4,7-8,10-11H2,1H3,(H,17,18) |
| InChIKey | YWUHNTHWIHPBPG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |