C13H22N2S — CID 65169326
N-(2-cyclohexylethyl)-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 65169326) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-cyclohexylethyl)-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65169326 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-(2-cyclohexylethyl)-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NCCC2CCCCC2)sc1C |
| InChI | InChI=1S/C13H22N2S/c1-10-11(2)16-13(15-10)14-9-8-12-6-4-3-5-7-12/h12H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | YIYLYYAIGKYGBS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |