C12H21N3S — CID 107648019
N-(2-cyclohexylethyl)-5-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 107648019) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-5-ethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-cyclohexylethyl)-5-ethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648019 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(2-cyclohexylethyl)-5-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCc1nnc(NCCC2CCCCC2)s1 |
| InChI | InChI=1S/C12H21N3S/c1-2-11-14-15-12(16-11)13-9-8-10-6-4-3-5-7-10/h10H,2-9H2,1H3,(H,13,15) |
| InChIKey | HYGLEJNUFCJEOM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |