C14H18N2OS — CID 79146165
4-methyl-N-(oxan-2-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 79146165) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-methyl-N-(oxan-2-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-methyl-N-(oxan-2-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79146165 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-methyl-N-(oxan-2-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(NCC3CCCCO3)nc12 |
| InChI | InChI=1S/C14H18N2OS/c1-10-5-4-7-12-13(10)16-14(18-12)15-9-11-6-2-3-8-17-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,15,16) |
| InChIKey | PNXAGJYHKBTBAP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |