C16H14F2N2S — CID 79130673
N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 79130673) has the molecular formula C16H14F2N2S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-benzothiazol-2-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79130673 |
| Molecular Formula | C16H14F2N2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1cccc2sc(NCCc3cc(F)cc(F)c3)nc12 |
| InChI | InChI=1S/C16H14F2N2S/c1-10-3-2-4-14-15(10)20-16(21-14)19-6-5-11-7-12(17)9-13(18)8-11/h2-4,7-9H,5-6H2,1H3,(H,19,20) |
| InChIKey | UPOHFZWYDHKMLV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |