C15H23N3S — CID 106049330
N'-methyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 106049330) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N'-methyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-methyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106049330 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N'-methyl-N-(4-methyl-1,3-benzothiazol-2-yl)-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | Cc1cccc2sc(NCCCN(C)C(C)C)nc12 |
| InChI | InChI=1S/C15H23N3S/c1-11(2)18(4)10-6-9-16-15-17-14-12(3)7-5-8-13(14)19-15/h5,7-8,11H,6,9-10H2,1-4H3,(H,16,17) |
| InChIKey | PXGDMNPPBBHADD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|