C19H21N3OS — CID 5072919
4-(diethylamino)-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 5072919) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-(diethylamino)-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(diethylamino)-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 5072919 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(diethylamino)-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nc2nc3c(C)cccc3s2)cc1 |
| InChI | InChI=1S/C19H21N3OS/c1-4-22(5-2)15-11-9-14(10-12-15)18(23)21-19-20-17-13(3)7-6-8-16(17)24-19/h6-12H,4-5H2,1-3H3,(H,20,21,23) |
| InChIKey | WARCJJCDCZLDDA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |