C23H29F3NO6P — CID 57328667
N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 57328667) has the molecular formula C23H29F3NO6P and a molecular weight of 503.45 g/mol. Its IUPAC name is N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 57328667 |
| Molecular Formula | C23H29F3NO6P |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[dipropoxyphosphoryl-(4-methoxyphenyl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CCCOP(=O)(OCCC)C(NC(=O)COc1cccc(C(F)(F)F)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29F3NO6P/c1-4-13-32-34(29,33-14-5-2)22(17-9-11-19(30-3)12-10-17)27-21(28)16-31-20-8-6-7-18(15-20)23(24,25)26/h6-12,15,22H,4-5,13-14,16H2,1-3H3,(H,27,28) |
| InChIKey | ABGGQKXZCFFGQR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|