C21H25N2O7PS — CID 71519733
methyl 5-[diethoxyphosphoryl-[(5-methoxy-1,3-benzothiazol-2-yl)amino]methyl]-2-hydroxybenzoate (PubChem CID 71519733) has the molecular formula C21H25N2O7PS and a molecular weight of 480.48 g/mol. Its IUPAC name is methyl 5-[diethoxyphosphoryl-[(5-methoxy-1,3-benzothiazol-2-yl)amino]methyl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[diethoxyphosphoryl-[(5-methoxy-1,3-benzothiazol-2-yl)amino]methyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 71519733 |
| Molecular Formula | C21H25N2O7PS |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 5-[diethoxyphosphoryl-[(5-methoxy-1,3-benzothiazol-2-yl)amino]methyl]-2-hydroxybenzoate |
| SMILES | CCOP(=O)(OCC)C(Nc1nc2cc(OC)ccc2s1)c1ccc(O)c(C(=O)OC)c1 |
| InChI | InChI=1S/C21H25N2O7PS/c1-5-29-31(26,30-6-2)19(13-7-9-17(24)15(11-13)20(25)28-4)23-21-22-16-12-14(27-3)8-10-18(16)32-21/h7-12,19,24H,5-6H2,1-4H3,(H,22,23) |
| InChIKey | QKHXYVSKSUOZKQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|