C17H15N3O3S3 — CID 7513130
ethyl 5-[(5-methoxy-1,3-benzothiazol-2-yl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate (PubChem CID 7513130) has the molecular formula C17H15N3O3S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is ethyl 5-[(5-methoxy-1,3-benzothiazol-2-yl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 5-[(5-methoxy-1,3-benzothiazol-2-yl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7513130 |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | ethyl 5-[(5-methoxy-1,3-benzothiazol-2-yl)amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc3cc(OC)ccc3s2)c(SC#N)c1C |
| InChI | InChI=1S/C17H15N3O3S3/c1-4-23-16(21)14-9(2)13(24-8-18)15(26-14)20-17-19-11-7-10(22-3)5-6-12(11)25-17/h5-7H,4H2,1-3H3,(H,19,20) |
| InChIKey | KSBSLRNJSFKVOI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|