C20H22N2O4S3 — CID 41086479
ethyl 5-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate (PubChem CID 41086479) has the molecular formula C20H22N2O4S3 and a molecular weight of 450.61 g/mol. Its IUPAC name is ethyl 5-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 5-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 41086479 |
| Molecular Formula | C20H22N2O4S3 |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | ethyl 5-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCCSc2ccc(OC)cc2)c(SC#N)c1C |
| InChI | InChI=1S/C20H22N2O4S3/c1-4-26-20(24)18-13(2)17(28-12-21)19(29-18)22-16(23)6-5-11-27-15-9-7-14(25-3)8-10-15/h7-10H,4-6,11H2,1-3H3,(H,22,23) |
| InChIKey | WPZMGRCDLIXDQK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|