C24H30N2O4S — CID 2072079
ethyl 4-cyano-3-methyl-5-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]thiophene-2-carboxylate (PubChem CID 2072079) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is ethyl 4-cyano-3-methyl-5-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]thiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-methyl-5-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2072079 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | ethyl 4-cyano-3-methyl-5-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CCCOc2ccc(C(C)(C)CC)cc2)c(C#N)c1C |
| InChI | InChI=1S/C24H30N2O4S/c1-6-24(4,5)17-10-12-18(13-11-17)30-14-8-9-20(27)26-22-19(15-25)16(3)21(31-22)23(28)29-7-2/h10-13H,6-9,14H2,1-5H3,(H,26,27) |
| InChIKey | SUVXRDJEMMFKDB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|