C15H14N2O4S2 — CID 158408319
ethyl 3-methyl-5-[(5-methylfuran-2-carbonyl)amino]-4-thiocyanatothiophene-2-carboxylate (PubChem CID 158408319) has the molecular formula C15H14N2O4S2 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 3-methyl-5-[(5-methylfuran-2-carbonyl)amino]-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[(5-methylfuran-2-carbonyl)amino]-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 158408319 |
| Molecular Formula | C15H14N2O4S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | ethyl 3-methyl-5-[(5-methylfuran-2-carbonyl)amino]-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(C)o2)c(SC#N)c1C |
| InChI | InChI=1S/C15H14N2O4S2/c1-4-20-15(19)12-9(3)11(22-7-16)14(23-12)17-13(18)10-6-5-8(2)21-10/h5-6H,4H2,1-3H3,(H,17,18) |
| InChIKey | SOCWWTMOESDOJZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|