C24H31N3O5S3 — CID 23824993
ethyl 5-[[4-[bis(2-methylpropyl)sulfamoyl]benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate (PubChem CID 23824993) has the molecular formula C24H31N3O5S3 and a molecular weight of 537.73 g/mol. Its IUPAC name is ethyl 5-[[4-[bis(2-methylpropyl)sulfamoyl]benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate.
| Compound Name | ethyl 5-[[4-[bis(2-methylpropyl)sulfamoyl]benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
|---|---|
| PubChem CID | 23824993 |
| Molecular Formula | C24H31N3O5S3 |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | ethyl 5-[[4-[bis(2-methylpropyl)sulfamoyl]benzoyl]amino]-3-methyl-4-thiocyanatothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc2)c(SC#N)c1C |
| InChI | InChI=1S/C24H31N3O5S3/c1-7-32-24(29)21-17(6)20(33-14-25)23(34-21)26-22(28)18-8-10-19(11-9-18)35(30,31)27(12-15(2)3)13-16(4)5/h8-11,15-16H,7,12-13H2,1-6H3,(H,26,28) |
| InChIKey | HPGMRDGEKHLGAD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|