C19H22N2O5S2 — CID 41086519
ethyl N-[2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]thiophene-3-carbonyl]carbamate (PubChem CID 41086519) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is ethyl N-[2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 41086519 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | ethyl N-[2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)CCCSc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-3-26-19(24)21-17(23)15-10-12-28-18(15)20-16(22)5-4-11-27-14-8-6-13(25-2)7-9-14/h6-10,12H,3-5,11H2,1-2H3,(H,20,22)(H,21,23,24) |
| InChIKey | KGPQPVWMTDISOH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|