C22H20N2O4S — CID 7167159
ethyl N-[2-[(2,2-diphenylacetyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 7167159) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is ethyl N-[2-[(2,2-diphenylacetyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(2,2-diphenylacetyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167159 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | ethyl N-[2-[(2,2-diphenylacetyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4S/c1-2-28-22(27)24-19(25)17-13-14-29-21(17)23-20(26)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-14,18H,2H2,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | XANRVDSPKZOQMW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |