C13H12N4O4S — CID 121464823
ethyl N-[2-(pyrimidine-5-carbonylamino)thiophene-3-carbonyl]carbamate (PubChem CID 121464823) has the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. Its IUPAC name is ethyl N-[2-(pyrimidine-5-carbonylamino)thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-(pyrimidine-5-carbonylamino)thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 121464823 |
| Molecular Formula | C13H12N4O4S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethyl N-[2-(pyrimidine-5-carbonylamino)thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1cncnc1 |
| InChI | InChI=1S/C13H12N4O4S/c1-2-21-13(20)17-11(19)9-3-4-22-12(9)16-10(18)8-5-14-7-15-6-8/h3-7H,2H2,1H3,(H,16,18)(H,17,19,20) |
| InChIKey | SJYBCASXYHCJDM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |