C16H16N2O6S2 — CID 7565713
ethyl N-[2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 7565713) has the molecular formula C16H16N2O6S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is ethyl N-[2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7565713 |
| Molecular Formula | C16H16N2O6S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | ethyl N-[2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H16N2O6S2/c1-3-24-16(21)18-14(20)12-7-8-25-15(12)17-13(19)10-5-4-6-11(9-10)26(2,22)23/h4-9H,3H2,1-2H3,(H,17,19)(H,18,20,21) |
| InChIKey | BKTPJFSCDIIGJK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |