C19H23NO5S2 — CID 18131623
ethyl 4-(2-methylpropyl)-2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carboxylate (PubChem CID 18131623) has the molecular formula C19H23NO5S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 4-(2-methylpropyl)-2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2-methylpropyl)-2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18131623 |
| Molecular Formula | C19H23NO5S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | ethyl 4-(2-methylpropyl)-2-[(3-methylsulfonylbenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC(C)C)csc1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H23NO5S2/c1-5-25-19(22)16-14(9-12(2)3)11-26-18(16)20-17(21)13-7-6-8-15(10-13)27(4,23)24/h6-8,10-12H,5,9H2,1-4H3,(H,20,21) |
| InChIKey | MLQMWDYBUFASFS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |