C18H20FNO3S — CID 759977
ethyl 2-[(2-fluorobenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate (PubChem CID 759977) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 2-[(2-fluorobenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-fluorobenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 759977 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl 2-[(2-fluorobenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC(C)C)csc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H20FNO3S/c1-4-23-18(22)15-12(9-11(2)3)10-24-17(15)20-16(21)13-7-5-6-8-14(13)19/h5-8,10-11H,4,9H2,1-3H3,(H,20,21) |
| InChIKey | PBAAKXCPJZOVOF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |