C17H18NO3S- — CID 5147210
2-[(2-methylbenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate (PubChem CID 5147210) has the molecular formula C17H18NO3S- and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-[(2-methylbenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate.
| Compound Name | 2-[(2-methylbenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5147210 |
| Molecular Formula | C17H18NO3S- |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[(2-methylbenzoyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate |
| SMILES | Cc1ccccc1C(=O)Nc1scc(CC(C)C)c1C(=O)[O-] |
| InChI | InChI=1S/C17H19NO3S/c1-10(2)8-12-9-22-16(14(12)17(20)21)18-15(19)13-7-5-4-6-11(13)3/h4-7,9-10H,8H2,1-3H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | JPYMTYQKHISSPA-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |