C15H16BrNO3S2 — CID 55760685
methyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate (PubChem CID 55760685) has the molecular formula C15H16BrNO3S2 and a molecular weight of 402.34 g/mol. Its IUPAC name is methyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55760685 |
| Molecular Formula | C15H16BrNO3S2 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | methyl 2-[(3-bromothiophene-2-carbonyl)amino]-4-(2-methylpropyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(CC(C)C)csc1NC(=O)c1sccc1Br |
| InChI | InChI=1S/C15H16BrNO3S2/c1-8(2)6-9-7-22-14(11(9)15(19)20-3)17-13(18)12-10(16)4-5-21-12/h4-5,7-8H,6H2,1-3H3,(H,17,18) |
| InChIKey | YTHUFKCGSFJNCQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |